CAS No: 80278-94-0, Chemical Name: 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
the physical and chemical property of 80278-94-0, 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole is provided by ChemNet.com
ChemNet > CAS > 80278-94-0 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
80278-94-0 1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole
Nama produk |
1,2,3,3a,4,8b-hexahydrocyclopenta[b]indole |
Sinonim |
cyclopent[b]indole, 1,2,3,3a,4,8b-hexahydro- |
MF |
C11H13N |
Berat Molekul |
159.2276 |
InChI |
InChI=1/C11H13N/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10/h1-2,4,6,9,11-12H,3,5,7H2 |
CAS NO |
80278-94-0 |
Struktur Molekul |
|
Kepadatan |
1.07g/cm3 |
Titik didih |
256.522°C at 760 mmHg |
Indeks bias |
1.573 |
Titik nyala |
112.54°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
|
|